missing translation for 'onlineSavingsMsg'
Learn More
Learn More
3'-Nitropropiofenona, 97 %, Thermo Scientific™
59.50€ - 733.00€
Identificadores de productos químicos
| CAS | 17408-16-1 |
|---|---|
| Fórmula molecular | C9H9NO3 |
| Peso molecular (g/mol) | 179.175 |
| Número MDL | MFCD00051516 |
| Clave InChI | VSPOTMOYDHRALZ-UHFFFAOYSA-N |
| Sinónimo | 3'-nitropropiophenone, 1-3-nitrophenyl propan-1-one, m-nitropropiophenone, 3-nitrophenyl ethyl ketone, 1-propanone, 1-3-nitrophenyl, m-nitropropio-phenone, 3;-nitropropiophenone, acmc-209e7u, 3-nitropropiophenone, 1-3-nitrophenyl propan-l-one |
| PubChem CID | 87096 |
| Nombre IUPAC | 1-(3-nitrofenil)propan-1-ona |
| SMILES | CCC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| Código de producto | Marca | Cantidad | Precio | Cantidad y disponibilidad | |||||
|---|---|---|---|---|---|---|---|---|---|
| Código de producto | Marca | Cantidad | Precio | Cantidad y disponibilidad | |||||
|
11461938
|
Thermo Scientific Alfa Aesar
A14554.06 |
5 g | N/A | ||||||
|
11471938
|
Thermo Scientific Alfa Aesar
A14554.14 |
25 g | N/A | ||||||
|
11481938
|
Thermo Scientific Alfa Aesar
A14554.22 |
100 g | N/A | ||||||
Descripción
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identificadores de productos químicos
| 17408-16-1 | |
| 179.175 | |
| VSPOTMOYDHRALZ-UHFFFAOYSA-N | |
| 87096 | |
| CCC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| C9H9NO3 | |
| MFCD00051516 | |
| 3'-nitropropiophenone, 1-3-nitrophenyl propan-1-one, m-nitropropiophenone, 3-nitrophenyl ethyl ketone, 1-propanone, 1-3-nitrophenyl, m-nitropropio-phenone, 3;-nitropropiophenone, acmc-209e7u, 3-nitropropiophenone, 1-3-nitrophenyl propan-l-one | |
| 1-(3-nitrofenil)propan-1-ona |
Especificaciones
| 3'-Nitropropiophenone | |
| 99°C to 102°C | |
| MFCD00051516 | |
| 3'-nitropropiophenone, 1-3-nitrophenyl propan-1-one, m-nitropropiophenone, 3-nitrophenyl ethyl ketone, 1-propanone, 1-3-nitrophenyl, m-nitropropio-phenone, 3;-nitropropiophenone, acmc-209e7u, 3-nitropropiophenone, 1-3-nitrophenyl propan-l-one | |
| CCC(=O)C1=CC(=CC=C1)[N+](=O)[O-] | |
| 179.175 | |
| 179.18 |
| 17408-16-1 | |
| C9H9NO3 | |
| 1954069 | |
| VSPOTMOYDHRALZ-UHFFFAOYSA-N | |
| 1-(3-nitrofenil)propan-1-ona | |
| 87096 | |
| 97% |
Seguridad y manipulación
missing translation for 'einecsNumber' : 241-435-8
missing translation for 'tsca' : No
Recommended Storage : Temperaturas ambientes