missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Naphthol Yellow S, Thermo Scientific™
26.80€ - 355.00€
Identificadores de productos químicos
| CAS | 846-70-8 |
|---|---|
| Fórmula molecular | C10H4N2Na2O8S |
| Peso molecular (g/mol) | 358.188 |
| Número MDL | MFCD00003958 |
| Clave InChI | CTIQLGJVGNGFEW-UHFFFAOYSA-L |
| Sinónimo | C.I. 10316; 5,7-Dinitro-8-hydroxy-2-naphthalenesulfonic acid disodium salt |
| PubChem CID | 2724063 |
| ChEBI | CHEBI:87219 |
| Nombre IUPAC | disodio; 5,7-dinitro-8-oxidonaftaleno-2-sulfonato |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)[O-])C(=C(C=C2[N+](=O)[O-])[N+](=O)[O-])[O-].[Na+].[Na+] |
Descripción
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identificadores de productos químicos
| 846-70-8 | |
| 358.188 | |
| CTIQLGJVGNGFEW-UHFFFAOYSA-L | |
| 2724063 | |
| disodio; 5,7-dinitro-8-oxidonaftaleno-2-sulfonato |
| C10H4N2Na2O8S | |
| MFCD00003958 | |
| C.I. 10316; 5,7-Dinitro-8-hydroxy-2-naphthalenesulfonic acid disodium salt | |
| CHEBI:87219 | |
| C1=CC2=C(C=C1S(=O)(=O)[O-])C(=C(C=C2[N+](=O)[O-])[N+](=O)[O-])[O-].[Na+].[Na+] |
Especificaciones
| Naphthol Yellow S | |
| 846-70-8 | |
| MFCD00003958 | |
| 14,6393 | |
| CTIQLGJVGNGFEW-UHFFFAOYSA-L | |
| disodio; 5,7-dinitro-8-oxidonaftaleno-2-sulfonato | |
| 2724063 | |
| 358.2 |
| >300°C | |
| C10H4N2Na2O8S | |
| 2708476 | |
| C.I. 10316; 5,7-Dinitro-8-hydroxy-2-naphthalenesulfonic acid disodium salt | |
| C1=CC2=C(C=C1S(=O)(=O)[O-])C(=C(C=C2[N+](=O)[O-])[N+](=O)[O-])[O-].[Na+].[Na+] | |
| 358.188 | |
| CHEBI:87219 |
Seguridad y manipulación
missing translation for 'einecsNumber' : 212-690-2
missing translation for 'rtecsNumber' : QK1813000
missing translation for 'tsca' : Yes
Recommended Storage : Temperaturas ambientes